C27H38N2O5 — CID 25141514
N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-dimethoxy-N'-(3-methoxy-2-methylbenzoyl)-4-methylbenzohydrazide (PubChem CID 25141514) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-dimethoxy-N'-(3-methoxy-2-methylbenzoyl)-4-methylbenzohydrazide.
| Compound Name | N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-dimethoxy-N'-(3-methoxy-2-methylbenzoyl)-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 25141514 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-dimethoxy-N'-(3-methoxy-2-methylbenzoyl)-4-methylbenzohydrazide |
| SMILES | CCC[C@H](N(NC(=O)c1cccc(OC)c1C)C(=O)c1cc(OC)c(C)c(OC)c1)C(C)(C)C |
| InChI | InChI=1S/C27H38N2O5/c1-10-12-24(27(4,5)6)29(28-25(30)20-13-11-14-21(32-7)17(20)2)26(31)19-15-22(33-8)18(3)23(16-19)34-9/h11,13-16,24H,10,12H2,1-9H3,(H,28,30)/t24-/m0/s1 |
| InChIKey | FPNNIIQVHVRLCF-DEOSSOPVSA-N |
| XLogP | 5.33 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|