C26H35ClN2O2 — CID 67499677
N'-(2-chlorobenzoyl)-N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethylbenzohydrazide (PubChem CID 67499677) has the molecular formula C26H35ClN2O2 and a molecular weight of 443.03 g/mol. Its IUPAC name is N'-(2-chlorobenzoyl)-N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethylbenzohydrazide.
| Compound Name | N'-(2-chlorobenzoyl)-N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethylbenzohydrazide |
|---|---|
| PubChem CID | 67499677 |
| Molecular Formula | C26H35ClN2O2 |
| Molecular Weight | 443.03 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N'-(2-chlorobenzoyl)-N-[(3S)-2,2-dimethylhexan-3-yl]-3,5-diethylbenzohydrazide |
| SMILES | CCC[C@H](N(NC(=O)c1ccccc1Cl)C(=O)c1cc(CC)cc(CC)c1)C(C)(C)C |
| InChI | InChI=1S/C26H35ClN2O2/c1-7-12-23(26(4,5)6)29(28-24(30)21-13-10-11-14-22(21)27)25(31)20-16-18(8-2)15-19(9-3)17-20/h10-11,13-17,23H,7-9,12H2,1-6H3,(H,28,30)/t23-/m0/s1 |
| InChIKey | ADQNVCHNIPGXGY-QHCPKHFHSA-N |
| XLogP | 6.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.03 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|