C23H28ClFN2O2 — CID 42644920
2-chloro-N'-(4-fluorobenzoyl)-N'-nonan-5-ylbenzohydrazide (PubChem CID 42644920) has the molecular formula C23H28ClFN2O2 and a molecular weight of 418.94 g/mol. Its IUPAC name is 2-chloro-N'-(4-fluorobenzoyl)-N'-nonan-5-ylbenzohydrazide.
| Compound Name | 2-chloro-N'-(4-fluorobenzoyl)-N'-nonan-5-ylbenzohydrazide |
|---|---|
| PubChem CID | 42644920 |
| Molecular Formula | C23H28ClFN2O2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-chloro-N'-(4-fluorobenzoyl)-N'-nonan-5-ylbenzohydrazide |
| SMILES | CCCCC(CCCC)N(NC(=O)c1ccccc1Cl)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H28ClFN2O2/c1-3-5-9-19(10-6-4-2)27(23(29)17-13-15-18(25)16-14-17)26-22(28)20-11-7-8-12-21(20)24/h7-8,11-16,19H,3-6,9-10H2,1-2H3,(H,26,28) |
| InChIKey | QEFZXIBLJLSJFU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|