C18H20FNO — CID 2201408
4-fluoro-N-[(1R)-1-phenylpentyl]benzamide (PubChem CID 2201408) has the molecular formula C18H20FNO and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-fluoro-N-[(1R)-1-phenylpentyl]benzamide.
| Compound Name | 4-fluoro-N-[(1R)-1-phenylpentyl]benzamide |
|---|---|
| PubChem CID | 2201408 |
| Molecular Formula | C18H20FNO |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 4-fluoro-N-[(1R)-1-phenylpentyl]benzamide |
| SMILES | CCCC[C@@H](NC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20FNO/c1-2-3-9-17(14-7-5-4-6-8-14)20-18(21)15-10-12-16(19)13-11-15/h4-8,10-13,17H,2-3,9H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | MVZVTUURBAVKJA-QGZVFWFLSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |