1-phenylhexylcarbamic acid

C13H19NO2 — CID 21477897

IUPAC1-phenylhexylcarbamic acid
SMILESCCCCCC(NC(=O)O)c1ccccc1
InChIInChI=1S/C13H19NO2/c1-2-3-5-10-12(14-13(15)16)11-8-6-4-7-9-11/h4,6-9,12,14H,2-3,5,10H2,1H3,(H,15,16)
InChIKeyAAMUUMKHJFOGPE-UHFFFAOYSA-N
MW221.30 g/mol
LogP3.58
Rot. Bonds6

About 1-phenylhexylcarbamic acid

1-phenylhexylcarbamic acid (PubChem CID 21477897) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-phenylhexylcarbamic acid.

Molecular Properties

Compound Name1-phenylhexylcarbamic acid
PubChem CID21477897
Molecular FormulaC13H19NO2
Molecular Weight221.30 g/mol
Exact Mass221.14
IUPAC Name1-phenylhexylcarbamic acid
SMILESCCCCCC(NC(=O)O)c1ccccc1
InChIInChI=1S/C13H19NO2/c1-2-3-5-10-12(14-13(15)16)11-8-6-4-7-9-11/h4,6-9,12,14H,2-3,5,10H2,1H3,(H,15,16)
InChIKeyAAMUUMKHJFOGPE-UHFFFAOYSA-N
XLogP3.58
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.30
LogP ≤ 53.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 1-phenylhexylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-phenylhexylcarbamic acid?
The IUPAC name of 1-phenylhexylcarbamic acid (CID 21477897) is 1-phenylhexylcarbamic acid.
What is the SMILES notation for 1-phenylhexylcarbamic acid?
The canonical SMILES for 1-phenylhexylcarbamic acid is CCCCCC(NC(=O)O)c1ccccc1.
What is the InChIKey of 1-phenylhexylcarbamic acid?
The InChIKey is AAMUUMKHJFOGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-3-5-10-12(14-13(15)16)11-8-6-4-7-9-11/h4,6-9,12,14H,2-3,5,10H2,1H3,(H,15,16).
What are the key properties of 1-phenylhexylcarbamic acid?
1-phenylhexylcarbamic acid has a molecular weight of 221.30 g/mol, XLogP of 3.58, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhexylcarbamic acid is sourced from PubChem (CID 21477897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).