About 1-phenylhexylthiourea
1-phenylhexylthiourea (PubChem CID 122437154) has the molecular formula C13H20N2S
and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-phenylhexylthiourea.
Molecular Properties
| Compound Name | 1-phenylhexylthiourea |
| PubChem CID | 122437154 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-phenylhexylthiourea |
| SMILES | CCCCCC(NC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C13H20N2S/c1-2-3-5-10-12(15-13(14)16)11-8-6-4-7-9-11/h4,6-9,12H,2-3,5,10H2,1H3,(H3,14,15,16) |
| InChIKey | WUJNOWDRWCQSEO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylhexylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylhexylthiourea?
The IUPAC name of 1-phenylhexylthiourea (CID 122437154) is 1-phenylhexylthiourea.
What is the SMILES notation for 1-phenylhexylthiourea?
The canonical SMILES for 1-phenylhexylthiourea is CCCCCC(NC(N)=S)c1ccccc1.
What is the InChIKey of 1-phenylhexylthiourea?
The InChIKey is WUJNOWDRWCQSEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2S/c1-2-3-5-10-12(15-13(14)16)11-8-6-4-7-9-11/h4,6-9,12H,2-3,5,10H2,1H3,(H3,14,15,16).
What are the key properties of 1-phenylhexylthiourea?
1-phenylhexylthiourea has a molecular weight of 236.38 g/mol, XLogP of 3.14, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylhexylthiourea is sourced from PubChem (CID 122437154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).