C16H25NO2 — CID 67252081
1-phenylnonylcarbamic acid (PubChem CID 67252081) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-phenylnonylcarbamic acid.
| Compound Name | 1-phenylnonylcarbamic acid |
|---|---|
| PubChem CID | 67252081 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1-phenylnonylcarbamic acid |
| SMILES | CCCCCCCCC(NC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H25NO2/c1-2-3-4-5-6-10-13-15(17-16(18)19)14-11-8-7-9-12-14/h7-9,11-12,15,17H,2-6,10,13H2,1H3,(H,18,19) |
| InChIKey | NRHLLQGOXROYEX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|