C20H23BrN2S — CID 175374983
1-(7-bromo-9H-fluoren-2-yl)hexylthiourea (PubChem CID 175374983) has the molecular formula C20H23BrN2S and a molecular weight of 403.39 g/mol. Its IUPAC name is 1-(7-bromo-9H-fluoren-2-yl)hexylthiourea.
| Compound Name | 1-(7-bromo-9H-fluoren-2-yl)hexylthiourea |
|---|---|
| PubChem CID | 175374983 |
| Molecular Formula | C20H23BrN2S |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1-(7-bromo-9H-fluoren-2-yl)hexylthiourea |
| SMILES | CCCCCC(NC(N)=S)c1ccc2c(c1)Cc1cc(Br)ccc1-2 |
| InChI | InChI=1S/C20H23BrN2S/c1-2-3-4-5-19(23-20(22)24)13-6-8-17-14(10-13)11-15-12-16(21)7-9-18(15)17/h6-10,12,19H,2-5,11H2,1H3,(H3,22,23,24) |
| InChIKey | XSGVBGXVADDLNP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|