C11H16N2O — CID 2852079
1-phenylbutylurea (PubChem CID 2852079) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-phenylbutylurea.
| Compound Name | 1-phenylbutylurea |
|---|---|
| PubChem CID | 2852079 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-phenylbutylurea |
| SMILES | CCCC(NC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C11H16N2O/c1-2-6-10(13-11(12)14)9-7-4-3-5-8-9/h3-5,7-8,10H,2,6H2,1H3,(H3,12,13,14) |
| InChIKey | YZVVKQXHKDSVEB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |