C17H12ClFO3 — CID 10615548
1-(2-chlorophenyl)-5-(4-fluorophenyl)pentane-1,3,5-trione (PubChem CID 10615548) has the molecular formula C17H12ClFO3 and a molecular weight of 318.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-5-(4-fluorophenyl)pentane-1,3,5-trione.
| Compound Name | 1-(2-chlorophenyl)-5-(4-fluorophenyl)pentane-1,3,5-trione |
|---|---|
| PubChem CID | 10615548 |
| Molecular Formula | C17H12ClFO3 |
| Molecular Weight | 318.73 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(2-chlorophenyl)-5-(4-fluorophenyl)pentane-1,3,5-trione |
| SMILES | O=C(CC(=O)c1ccc(F)cc1)CC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H12ClFO3/c18-15-4-2-1-3-14(15)17(22)10-13(20)9-16(21)11-5-7-12(19)8-6-11/h1-8H,9-10H2 |
| InChIKey | QTFDSAFNICJKQX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|