C15H10BrFO2 — CID 131954889
1-(4-bromophenyl)-3-(4-fluorophenyl)propane-1,3-dione (PubChem CID 131954889) has the molecular formula C15H10BrFO2 and a molecular weight of 321.15 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-fluorophenyl)propane-1,3-dione.
| Compound Name | 1-(4-bromophenyl)-3-(4-fluorophenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 131954889 |
| Molecular Formula | C15H10BrFO2 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-fluorophenyl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccc(Br)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10BrFO2/c16-12-5-1-10(2-6-12)14(18)9-15(19)11-3-7-13(17)8-4-11/h1-8H,9H2 |
| InChIKey | NONWBQYIMDRQFH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|