C16H11BrO3 — CID 162856895
1-(4-bromophenyl)-4-phenylbutane-1,2,4-trione (PubChem CID 162856895) has the molecular formula C16H11BrO3 and a molecular weight of 331.17 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-phenylbutane-1,2,4-trione.
| Compound Name | 1-(4-bromophenyl)-4-phenylbutane-1,2,4-trione |
|---|---|
| PubChem CID | 162856895 |
| Molecular Formula | C16H11BrO3 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-(4-bromophenyl)-4-phenylbutane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1ccccc1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H11BrO3/c17-13-8-6-12(7-9-13)16(20)15(19)10-14(18)11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | APDXFEASFJBTAO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|