C23H18ClF2NO — CID 71429459
N-[4,4-bis(4-fluorophenyl)but-3-enyl]-2-chlorobenzamide (PubChem CID 71429459) has the molecular formula C23H18ClF2NO and a molecular weight of 397.85 g/mol. Its IUPAC name is N-[4,4-bis(4-fluorophenyl)but-3-enyl]-2-chlorobenzamide.
| Compound Name | N-[4,4-bis(4-fluorophenyl)but-3-enyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 71429459 |
| Molecular Formula | C23H18ClF2NO |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-[4,4-bis(4-fluorophenyl)but-3-enyl]-2-chlorobenzamide |
| SMILES | O=C(NCCC=C(c1ccc(F)cc1)c1ccc(F)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C23H18ClF2NO/c24-22-6-2-1-4-21(22)23(28)27-15-3-5-20(16-7-11-18(25)12-8-16)17-9-13-19(26)14-10-17/h1-2,4-14H,3,15H2,(H,27,28) |
| InChIKey | TWALXEWUYDUJGR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|