C18H16ClF2N3O3 — CID 35929500
N-[4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 35929500) has the molecular formula C18H16ClF2N3O3 and a molecular weight of 395.79 g/mol. Its IUPAC name is N-[4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 35929500 |
| Molecular Formula | C18H16ClF2N3O3 |
| Molecular Weight | 395.79 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H16ClF2N3O3/c19-14-5-2-1-4-12(14)18(27)24-23-16(25)6-3-9-22-17(26)13-8-7-11(20)10-15(13)21/h1-2,4-5,7-8,10H,3,6,9H2,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | QIMYSDCBFUXECT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|