C22H24F2N4O3 — CID 29493687
N-[4-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 29493687) has the molecular formula C22H24F2N4O3 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 29493687 |
| Molecular Formula | C22H24F2N4O3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[4-[2-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]hydrazinyl]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24F2N4O3/c23-16-9-10-17(18(24)13-16)22(31)25-11-3-8-20(29)26-27-21(30)14-28-12-4-6-15-5-1-2-7-19(15)28/h1-2,5,7,9-10,13H,3-4,6,8,11-12,14H2,(H,25,31)(H,26,29)(H,27,30) |
| InChIKey | SRZYSZZGZHFKGZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|