C20H22ClN3O2 — CID 24554708
3-(4-chlorophenyl)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide (PubChem CID 24554708) has the molecular formula C20H22ClN3O2 and a molecular weight of 371.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide.
| Compound Name | 3-(4-chlorophenyl)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 24554708 |
| Molecular Formula | C20H22ClN3O2 |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(4-chlorophenyl)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCc1ccc(Cl)cc1)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C20H22ClN3O2/c21-17-10-7-15(8-11-17)9-12-19(25)22-23-20(26)14-24-13-3-5-16-4-1-2-6-18(16)24/h1-2,4,6-8,10-11H,3,5,9,12-14H2,(H,22,25)(H,23,26) |
| InChIKey | BFWWNQAQSRMKIQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|