C23H23ClN4O3 — CID 26047098
3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide (PubChem CID 26047098) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide.
| Compound Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 26047098 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]propanehydrazide |
| SMILES | O=C(CCc1ncc(-c2ccc(Cl)cc2)o1)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C23H23ClN4O3/c24-18-9-7-17(8-10-18)20-14-25-23(31-20)12-11-21(29)26-27-22(30)15-28-13-3-5-16-4-1-2-6-19(16)28/h1-2,4,6-10,14H,3,5,11-13,15H2,(H,26,29)(H,27,30) |
| InChIKey | KWRWKXRLZCRFKD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|