C22H24N4O4 — CID 7479503
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide (PubChem CID 7479503) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide |
|---|---|
| PubChem CID | 7479503 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4-(2-oxo-1,3-benzoxazol-3-yl)butanehydrazide |
| SMILES | O=C(CCCn1c(=O)oc2ccccc21)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24N4O4/c27-20(12-6-14-26-18-10-3-4-11-19(18)30-22(26)29)23-24-21(28)15-25-13-5-8-16-7-1-2-9-17(16)25/h1-4,7,9-11H,5-6,8,12-15H2,(H,23,27)(H,24,28) |
| InChIKey | HXKHRWAJRKSCRR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|