C16H20F3N3O3 — CID 8969590
(3R)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4,4,4-trifluoro-3-hydroxy-3-methylbutanehydrazide (PubChem CID 8969590) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is (3R)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4,4,4-trifluoro-3-hydroxy-3-methylbutanehydrazide.
| Compound Name | (3R)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4,4,4-trifluoro-3-hydroxy-3-methylbutanehydrazide |
|---|---|
| PubChem CID | 8969590 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (3R)-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-4,4,4-trifluoro-3-hydroxy-3-methylbutanehydrazide |
| SMILES | C[C@@](O)(CC(=O)NNC(=O)CN1CCCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C16H20F3N3O3/c1-15(25,16(17,18)19)9-13(23)20-21-14(24)10-22-8-4-6-11-5-2-3-7-12(11)22/h2-3,5,7,25H,4,6,8-10H2,1H3,(H,20,23)(H,21,24)/t15-/m1/s1 |
| InChIKey | SMNZIFIMJNCHCS-OAHLLOKOSA-N |
| XLogP | 1.29 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|