C20H27N5O2 — CID 78894028
3-tert-butyl-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-1-methylpyrazole-5-carbohydrazide (PubChem CID 78894028) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-tert-butyl-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-1-methylpyrazole-5-carbohydrazide.
| Compound Name | 3-tert-butyl-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-1-methylpyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 78894028 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-tert-butyl-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-1-methylpyrazole-5-carbohydrazide |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C20H27N5O2/c1-20(2,3)17-12-16(24(4)23-17)19(27)22-21-18(26)13-25-11-7-9-14-8-5-6-10-15(14)25/h5-6,8,10,12H,7,9,11,13H2,1-4H3,(H,21,26)(H,22,27) |
| InChIKey | DJIJXJSPZQIVOJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|