C16H17N5O2 — CID 27680928
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]pyrazine-2-carbohydrazide (PubChem CID 27680928) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]pyrazine-2-carbohydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 27680928 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]pyrazine-2-carbohydrazide |
| SMILES | O=C(CN1CCCc2ccccc21)NNC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H17N5O2/c22-15(19-20-16(23)13-10-17-7-8-18-13)11-21-9-3-5-12-4-1-2-6-14(12)21/h1-2,4,6-8,10H,3,5,9,11H2,(H,19,22)(H,20,23) |
| InChIKey | MKZAVIBKJQTKFY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|