C23H26N6O2 — CID 43070384
N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbohydrazide (PubChem CID 43070384) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 43070384 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-5-propan-2-yl-1-pyridin-2-ylpyrazole-4-carbohydrazide |
| SMILES | CC(C)c1c(C(=O)NNC(=O)CN2CCCc3ccccc32)cnn1-c1ccccn1 |
| InChI | InChI=1S/C23H26N6O2/c1-16(2)22-18(14-25-29(22)20-11-5-6-12-24-20)23(31)27-26-21(30)15-28-13-7-9-17-8-3-4-10-19(17)28/h3-6,8,10-12,14,16H,7,9,13,15H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | NEINDDVHZTXCTJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|