C21H22ClN3O3 — CID 8969580
(3S)-6-chloro-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3,4-dihydro-2H-chromene-3-carbohydrazide (PubChem CID 8969580) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is (3S)-6-chloro-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3,4-dihydro-2H-chromene-3-carbohydrazide.
| Compound Name | (3S)-6-chloro-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3,4-dihydro-2H-chromene-3-carbohydrazide |
|---|---|
| PubChem CID | 8969580 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (3S)-6-chloro-N'-[2-(3,4-dihydro-2H-quinolin-1-yl)acetyl]-3,4-dihydro-2H-chromene-3-carbohydrazide |
| SMILES | O=C(CN1CCCc2ccccc21)NNC(=O)[C@@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C21H22ClN3O3/c22-17-7-8-19-15(11-17)10-16(13-28-19)21(27)24-23-20(26)12-25-9-3-5-14-4-1-2-6-18(14)25/h1-2,4,6-8,11,16H,3,5,9-10,12-13H2,(H,23,26)(H,24,27)/t16-/m0/s1 |
| InChIKey | XTJAKNWSTLVWTE-INIZCTEOSA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|