C22H27ClN2O3 — CID 9086049
(3S)-N'-[2-(1-adamantyl)acetyl]-6-chloro-3,4-dihydro-2H-chromene-3-carbohydrazide (PubChem CID 9086049) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is (3S)-N'-[2-(1-adamantyl)acetyl]-6-chloro-3,4-dihydro-2H-chromene-3-carbohydrazide.
| Compound Name | (3S)-N'-[2-(1-adamantyl)acetyl]-6-chloro-3,4-dihydro-2H-chromene-3-carbohydrazide |
|---|---|
| PubChem CID | 9086049 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (3S)-N'-[2-(1-adamantyl)acetyl]-6-chloro-3,4-dihydro-2H-chromene-3-carbohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNC(=O)[C@@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C22H27ClN2O3/c23-18-1-2-19-16(7-18)6-17(12-28-19)21(27)25-24-20(26)11-22-8-13-3-14(9-22)5-15(4-13)10-22/h1-2,7,13-15,17H,3-6,8-12H2,(H,24,26)(H,25,27)/t13?,14?,15?,17-,22?/m0/s1 |
| InChIKey | BCNHNXGZRHALOD-LEJIWSMMSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|