C15H13ClN2O4 — CID 9086828
(3S)-6-chloro-N'-(furan-2-carbonyl)-3,4-dihydro-2H-chromene-3-carbohydrazide (PubChem CID 9086828) has the molecular formula C15H13ClN2O4 and a molecular weight of 320.73 g/mol. Its IUPAC name is (3S)-6-chloro-N'-(furan-2-carbonyl)-3,4-dihydro-2H-chromene-3-carbohydrazide.
| Compound Name | (3S)-6-chloro-N'-(furan-2-carbonyl)-3,4-dihydro-2H-chromene-3-carbohydrazide |
|---|---|
| PubChem CID | 9086828 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 320.73 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (3S)-6-chloro-N'-(furan-2-carbonyl)-3,4-dihydro-2H-chromene-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1COc2ccc(Cl)cc2C1)c1ccco1 |
| InChI | InChI=1S/C15H13ClN2O4/c16-11-3-4-12-9(7-11)6-10(8-22-12)14(19)17-18-15(20)13-2-1-5-21-13/h1-5,7,10H,6,8H2,(H,17,19)(H,18,20)/t10-/m0/s1 |
| InChIKey | PTYHPTVVQRMZDT-JTQLQIEISA-N |
| XLogP | 1.95 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|