C11H11ClO3 — CID 51514244
methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 51514244) has the molecular formula C11H11ClO3 and a molecular weight of 226.66 g/mol. Its IUPAC name is methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 51514244 |
| Molecular Formula | C11H11ClO3 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | COC(=O)[C@@H]1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C11H11ClO3/c1-14-11(13)8-4-7-5-9(12)2-3-10(7)15-6-8/h2-3,5,8H,4,6H2,1H3/t8-/m0/s1 |
| InChIKey | SPAAUUYJRNLHLI-QMMMGPOBSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |