C12H13ClO3 — CID 53408410
ethyl 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 53408410) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is ethyl 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | ethyl 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 53408410 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | ethyl 6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | CCOC(=O)C1COc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H13ClO3/c1-2-15-12(14)9-5-8-6-10(13)3-4-11(8)16-7-9/h3-4,6,9H,2,5,7H2,1H3 |
| InChIKey | JVNIZDSHIPLLAH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |