C24H22F2N4O3 — CID 30779997
2,4-difluoro-N-[4-oxo-4-[4-(phenylcarbamoylamino)anilino]butyl]benzamide (PubChem CID 30779997) has the molecular formula C24H22F2N4O3 and a molecular weight of 452.46 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-[4-(phenylcarbamoylamino)anilino]butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-[4-(phenylcarbamoylamino)anilino]butyl]benzamide |
|---|---|
| PubChem CID | 30779997 |
| Molecular Formula | C24H22F2N4O3 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-[4-(phenylcarbamoylamino)anilino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22F2N4O3/c25-16-8-13-20(21(26)15-16)23(32)27-14-4-7-22(31)28-18-9-11-19(12-10-18)30-24(33)29-17-5-2-1-3-6-17/h1-3,5-6,8-13,15H,4,7,14H2,(H,27,32)(H,28,31)(H2,29,30,33) |
| InChIKey | CBCCIMCAMSDJKC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|