C17H15BrF2N2O2 — CID 30448942
N-[4-(3-bromoanilino)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 30448942) has the molecular formula C17H15BrF2N2O2 and a molecular weight of 397.22 g/mol. Its IUPAC name is N-[4-(3-bromoanilino)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(3-bromoanilino)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 30448942 |
| Molecular Formula | C17H15BrF2N2O2 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-[4-(3-bromoanilino)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C17H15BrF2N2O2/c18-11-3-1-4-13(9-11)22-16(23)5-2-8-21-17(24)14-7-6-12(19)10-15(14)20/h1,3-4,6-7,9-10H,2,5,8H2,(H,21,24)(H,22,23) |
| InChIKey | ORSIPHWWOYWYOQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|