C18H14F2N2O2 — CID 134043041
N-[3-(3-ethynylanilino)-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 134043041) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is N-[3-(3-ethynylanilino)-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-(3-ethynylanilino)-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 134043041 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[3-(3-ethynylanilino)-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | C#Cc1cccc(NC(=O)CCNC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H14F2N2O2/c1-2-12-4-3-5-14(10-12)22-17(23)8-9-21-18(24)15-7-6-13(19)11-16(15)20/h1,3-7,10-11H,8-9H2,(H,21,24)(H,22,23) |
| InChIKey | CESVJXZZGNYWOY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|