C19H18N2O2 — CID 46529788
N-[3-(3-ethynylanilino)-3-oxopropyl]-2-methylbenzamide (PubChem CID 46529788) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[3-(3-ethynylanilino)-3-oxopropyl]-2-methylbenzamide.
| Compound Name | N-[3-(3-ethynylanilino)-3-oxopropyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46529788 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-[3-(3-ethynylanilino)-3-oxopropyl]-2-methylbenzamide |
| SMILES | C#Cc1cccc(NC(=O)CCNC(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C19H18N2O2/c1-3-15-8-6-9-16(13-15)21-18(22)11-12-20-19(23)17-10-5-4-7-14(17)2/h1,4-10,13H,11-12H2,2H3,(H,20,23)(H,21,22) |
| InChIKey | OIJSPMFTCVFUMV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|