C16H15F2N3O2 — CID 51312310
2,4-difluoro-N-[4-oxo-4-(pyridin-2-ylamino)butyl]benzamide (PubChem CID 51312310) has the molecular formula C16H15F2N3O2 and a molecular weight of 319.31 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(pyridin-2-ylamino)butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(pyridin-2-ylamino)butyl]benzamide |
|---|---|
| PubChem CID | 51312310 |
| Molecular Formula | C16H15F2N3O2 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(pyridin-2-ylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1ccccn1 |
| InChI | InChI=1S/C16H15F2N3O2/c17-11-6-7-12(13(18)10-11)16(23)20-9-3-5-15(22)21-14-4-1-2-8-19-14/h1-2,4,6-8,10H,3,5,9H2,(H,20,23)(H,19,21,22) |
| InChIKey | DDVXRWAXESYCIJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|