C13H12F2N4O2S — CID 29370798
2,4-difluoro-N-[4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butyl]benzamide (PubChem CID 29370798) has the molecular formula C13H12F2N4O2S and a molecular weight of 326.33 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butyl]benzamide |
|---|---|
| PubChem CID | 29370798 |
| Molecular Formula | C13H12F2N4O2S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(1,3,4-thiadiazol-2-ylamino)butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1nncs1 |
| InChI | InChI=1S/C13H12F2N4O2S/c14-8-3-4-9(10(15)6-8)12(21)16-5-1-2-11(20)18-13-19-17-7-22-13/h3-4,6-7H,1-2,5H2,(H,16,21)(H,18,19,20) |
| InChIKey | ZSTSQMFJRCGGCD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|