C18H16F2N4O2S3 — CID 55535820
2,4-difluoro-N-[4-oxo-4-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]butyl]benzamide (PubChem CID 55535820) has the molecular formula C18H16F2N4O2S3 and a molecular weight of 454.55 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 55535820 |
| Molecular Formula | C18H16F2N4O2S3 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]butyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C18H16F2N4O2S3/c19-11-5-6-13(14(20)9-11)16(26)21-7-1-4-15(25)22-17-23-24-18(29-17)28-10-12-3-2-8-27-12/h2-3,5-6,8-9H,1,4,7,10H2,(H,21,26)(H,22,23,25) |
| InChIKey | ZIKWNRLIBUJWNL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|