C17H22N4O2S3 — CID 86880279
N-[3-oxo-3-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]propyl]cyclohexanecarboxamide (PubChem CID 86880279) has the molecular formula C17H22N4O2S3 and a molecular weight of 410.59 g/mol. Its IUPAC name is N-[3-oxo-3-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-oxo-3-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 86880279 |
| Molecular Formula | C17H22N4O2S3 |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[3-oxo-3-[[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]amino]propyl]cyclohexanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCCC1)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C17H22N4O2S3/c22-14(8-9-18-15(23)12-5-2-1-3-6-12)19-16-20-21-17(26-16)25-11-13-7-4-10-24-13/h4,7,10,12H,1-3,5-6,8-9,11H2,(H,18,23)(H,19,20,22) |
| InChIKey | OUPRWLKRXLJPRK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|