C13H19N3O2S — CID 50875911
N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]cyclohexanecarboxamide (PubChem CID 50875911) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]cyclohexanecarboxamide.
| Compound Name | N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 50875911 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-[3-oxo-3-(1,3-thiazol-2-ylamino)propyl]cyclohexanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCCC1)Nc1nccs1 |
| InChI | InChI=1S/C13H19N3O2S/c17-11(16-13-15-8-9-19-13)6-7-14-12(18)10-4-2-1-3-5-10/h8-10H,1-7H2,(H,14,18)(H,15,16,17) |
| InChIKey | RXUCHCUFIRWQJY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |