C10H13FN2OS — CID 126794153
3-fluoro-N-(1,3-thiazol-2-yl)cyclohexane-1-carboxamide (PubChem CID 126794153) has the molecular formula C10H13FN2OS and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-fluoro-N-(1,3-thiazol-2-yl)cyclohexane-1-carboxamide.
| Compound Name | 3-fluoro-N-(1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 126794153 |
| Molecular Formula | C10H13FN2OS |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-fluoro-N-(1,3-thiazol-2-yl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCC(F)C1 |
| InChI | InChI=1S/C10H13FN2OS/c11-8-3-1-2-7(6-8)9(14)13-10-12-4-5-15-10/h4-5,7-8H,1-3,6H2,(H,12,13,14) |
| InChIKey | BTXIJIZEWXAKDT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |