C7H9N3OS — CID 130992868
N-(1,3-thiazol-2-yl)azetidine-2-carboxamide (PubChem CID 130992868) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)azetidine-2-carboxamide.
| Compound Name | N-(1,3-thiazol-2-yl)azetidine-2-carboxamide |
|---|---|
| PubChem CID | 130992868 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | N-(1,3-thiazol-2-yl)azetidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCN1 |
| InChI | InChI=1S/C7H9N3OS/c11-6(5-1-2-8-5)10-7-9-3-4-12-7/h3-5,8H,1-2H2,(H,9,10,11) |
| InChIKey | MDGNFEMVWIQWBV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |