C11H16N2OS — CID 141028315
2-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 141028315) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 141028315 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-cyclopentyl-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | CC(C(=O)Nc1nccs1)C1CCCC1 |
| InChI | InChI=1S/C11H16N2OS/c1-8(9-4-2-3-5-9)10(14)13-11-12-6-7-15-11/h6-9H,2-5H2,1H3,(H,12,13,14) |
| InChIKey | HJRBBNKMQKFENA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |