C12H19N3S2 — CID 3002367
1-[(1R)-1-cyclohexylethyl]-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 3002367) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is 1-[(1R)-1-cyclohexylethyl]-3-(1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-[(1R)-1-cyclohexylethyl]-3-(1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 3002367 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 1-[(1R)-1-cyclohexylethyl]-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | C[C@@H](NC(=S)Nc1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C12H19N3S2/c1-9(10-5-3-2-4-6-10)14-11(16)15-12-13-7-8-17-12/h7-10H,2-6H2,1H3,(H2,13,14,15,16)/t9-/m1/s1 |
| InChIKey | YMIPFHHBIUGWRO-SECBINFHSA-N |
| XLogP | 3.40 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|