C11H18N4S2 — CID 20980166
1-(2-piperidin-2-ylethyl)-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 20980166) has the molecular formula C11H18N4S2 and a molecular weight of 270.43 g/mol. Its IUPAC name is 1-(2-piperidin-2-ylethyl)-3-(1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-(2-piperidin-2-ylethyl)-3-(1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 20980166 |
| Molecular Formula | C11H18N4S2 |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-(2-piperidin-2-ylethyl)-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | S=C(NCCC1CCCCN1)Nc1nccs1 |
| InChI | InChI=1S/C11H18N4S2/c16-10(15-11-14-7-8-17-11)13-6-4-9-3-1-2-5-12-9/h7-9,12H,1-6H2,(H2,13,14,15,16) |
| InChIKey | XEBBIEPHEJCKPC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|