C12H21N3S — CID 79559653
N-[1-(azepan-2-yl)propan-2-yl]-1,3-thiazol-2-amine (PubChem CID 79559653) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is N-[1-(azepan-2-yl)propan-2-yl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-(azepan-2-yl)propan-2-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79559653 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-[1-(azepan-2-yl)propan-2-yl]-1,3-thiazol-2-amine |
| SMILES | CC(CC1CCCCCN1)Nc1nccs1 |
| InChI | InChI=1S/C12H21N3S/c1-10(15-12-14-7-8-16-12)9-11-5-3-2-4-6-13-11/h7-8,10-11,13H,2-6,9H2,1H3,(H,14,15) |
| InChIKey | ZEVQVIWYKCUJST-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |