C11H18N2OS — CID 97162415
2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]-1,3-thiazole (PubChem CID 97162415) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]-1,3-thiazole.
| Compound Name | 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 97162415 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]-1,3-thiazole |
| SMILES | C[C@H](OC[C@@H]1CCCCN1)c1nccs1 |
| InChI | InChI=1S/C11H18N2OS/c1-9(11-13-6-7-15-11)14-8-10-4-2-3-5-12-10/h6-7,9-10,12H,2-5,8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | UJTRIJYQNKRSJF-UWVGGRQHSA-N |
| XLogP | 2.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |