C12H19N3O — CID 97162411
2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]pyrazine (PubChem CID 97162411) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]pyrazine.
| Compound Name | 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]pyrazine |
|---|---|
| PubChem CID | 97162411 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 2-[(1S)-1-[[(2S)-piperidin-2-yl]methoxy]ethyl]pyrazine |
| SMILES | C[C@H](OC[C@@H]1CCCCN1)c1cnccn1 |
| InChI | InChI=1S/C12H19N3O/c1-10(12-8-13-6-7-15-12)16-9-11-4-2-3-5-14-11/h6-8,10-11,14H,2-5,9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | QOAHLQTYHOZDIL-QWRGUYRKSA-N |
| XLogP | 1.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |