C11H17N3O — CID 97162438
2-[(1R)-1-[[(2R)-pyrrolidin-2-yl]methoxy]ethyl]pyrazine (PubChem CID 97162438) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2-[(1R)-1-[[(2R)-pyrrolidin-2-yl]methoxy]ethyl]pyrazine.
| Compound Name | 2-[(1R)-1-[[(2R)-pyrrolidin-2-yl]methoxy]ethyl]pyrazine |
|---|---|
| PubChem CID | 97162438 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2-[(1R)-1-[[(2R)-pyrrolidin-2-yl]methoxy]ethyl]pyrazine |
| SMILES | C[C@@H](OC[C@H]1CCCN1)c1cnccn1 |
| InChI | InChI=1S/C11H17N3O/c1-9(11-7-12-5-6-14-11)15-8-10-3-2-4-13-10/h5-7,9-10,13H,2-4,8H2,1H3/t9-,10-/m1/s1 |
| InChIKey | IPJSVNUXBPDTKM-NXEZZACHSA-N |
| XLogP | 1.31 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |