C11H17N3OS — CID 103814463
(2R)-N-[1-(1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide (PubChem CID 103814463) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is (2R)-N-[1-(1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-[1-(1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 103814463 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | (2R)-N-[1-(1,3-thiazol-2-yl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(NC(=O)[C@H]1CCCCN1)c1nccs1 |
| InChI | InChI=1S/C11H17N3OS/c1-8(11-13-6-7-16-11)14-10(15)9-4-2-3-5-12-9/h6-9,12H,2-5H2,1H3,(H,14,15)/t8?,9-/m1/s1 |
| InChIKey | XBNFNBZFBAEGNN-YGPZHTELSA-N |
| XLogP | 1.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |