C11H18N4O — CID 104914790
(2S)-N-[1-(1H-imidazol-2-yl)ethyl]piperidine-2-carboxamide (PubChem CID 104914790) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (2S)-N-[1-(1H-imidazol-2-yl)ethyl]piperidine-2-carboxamide.
| Compound Name | (2S)-N-[1-(1H-imidazol-2-yl)ethyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 104914790 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2S)-N-[1-(1H-imidazol-2-yl)ethyl]piperidine-2-carboxamide |
| SMILES | CC(NC(=O)[C@@H]1CCCCN1)c1ncc[nH]1 |
| InChI | InChI=1S/C11H18N4O/c1-8(10-13-6-7-14-10)15-11(16)9-4-2-3-5-12-9/h6-9,12H,2-5H2,1H3,(H,13,14)(H,15,16)/t8?,9-/m0/s1 |
| InChIKey | ZBEZLBOTUSPOER-GKAPJAKFSA-N |
| XLogP | 0.73 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |