C10H15N3OS2 — CID 82915947
N-[1-(1,3-thiazol-2-yl)ethyl]thiomorpholine-3-carboxamide (PubChem CID 82915947) has the molecular formula C10H15N3OS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)ethyl]thiomorpholine-3-carboxamide.
| Compound Name | N-[1-(1,3-thiazol-2-yl)ethyl]thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82915947 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)ethyl]thiomorpholine-3-carboxamide |
| SMILES | CC(NC(=O)C1CSCCN1)c1nccs1 |
| InChI | InChI=1S/C10H15N3OS2/c1-7(10-12-3-5-16-10)13-9(14)8-6-15-4-2-11-8/h3,5,7-8,11H,2,4,6H2,1H3,(H,13,14) |
| InChIKey | QGWDNDKNSVFDHM-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |