C9H14N2OS — CID 144903789
2-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]propanamide (PubChem CID 144903789) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]propanamide.
| Compound Name | 2-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 144903789 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-methyl-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]propanamide |
| SMILES | CC(C)C(=O)N[C@H](C)c1nccs1 |
| InChI | InChI=1S/C9H14N2OS/c1-6(2)8(12)11-7(3)9-10-4-5-13-9/h4-7H,1-3H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | QSRBNGLUOOSESQ-SSDOTTSWSA-N |
| XLogP | 1.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |