C8H10N2O3S — CID 112617326
methyl 2-oxo-2-[1-(1,3-thiazol-2-yl)ethylamino]acetate (PubChem CID 112617326) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is methyl 2-oxo-2-[1-(1,3-thiazol-2-yl)ethylamino]acetate.
| Compound Name | methyl 2-oxo-2-[1-(1,3-thiazol-2-yl)ethylamino]acetate |
|---|---|
| PubChem CID | 112617326 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | methyl 2-oxo-2-[1-(1,3-thiazol-2-yl)ethylamino]acetate |
| SMILES | COC(=O)C(=O)NC(C)c1nccs1 |
| InChI | InChI=1S/C8H10N2O3S/c1-5(7-9-3-4-14-7)10-6(11)8(12)13-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | BOEMNTYSDCWWJA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|